C26H37FN4O2 — CID 123207168
4-N-[5-fluoro-4-[3-(oxan-4-ylmethylamino)phenyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine (PubChem CID 123207168) has the molecular formula C26H37FN4O2 and a molecular weight of 456.61 g/mol. Its IUPAC name is 4-N-[5-fluoro-4-[3-(oxan-4-ylmethylamino)phenyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-[5-fluoro-4-[3-(oxan-4-ylmethylamino)phenyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 123207168 |
| Molecular Formula | C26H37FN4O2 |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 4-N-[5-fluoro-4-[3-(oxan-4-ylmethylamino)phenyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine |
| SMILES | COCCNC1CCC(Nc2cc(-c3cccc(NCC4CCOCC4)c3)c(F)cn2)CC1 |
| InChI | InChI=1S/C26H37FN4O2/c1-32-14-11-28-21-5-7-22(8-6-21)31-26-16-24(25(27)18-30-26)20-3-2-4-23(15-20)29-17-19-9-12-33-13-10-19/h2-4,15-16,18-19,21-22,28-29H,5-14,17H2,1H3,(H,30,31) |
| InChIKey | ZNPAIGUTBCTMQN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|