C24H32ClN3O2 — CID 67691867
[4-[[5-chloro-4-[3-(oxan-4-ylmethylamino)phenyl]-2-pyridinyl]amino]cyclohexyl]methanol (PubChem CID 67691867) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is [4-[[5-chloro-4-[3-(oxan-4-ylmethylamino)phenyl]-2-pyridinyl]amino]cyclohexyl]methanol.
| Compound Name | [4-[[5-chloro-4-[3-(oxan-4-ylmethylamino)phenyl]-2-pyridinyl]amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 67691867 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | [4-[[5-chloro-4-[3-(oxan-4-ylmethylamino)phenyl]-2-pyridinyl]amino]cyclohexyl]methanol |
| SMILES | OCC1CCC(Nc2cc(-c3cccc(NCC4CCOCC4)c3)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C24H32ClN3O2/c25-23-15-27-24(28-20-6-4-18(16-29)5-7-20)13-22(23)19-2-1-3-21(12-19)26-14-17-8-10-30-11-9-17/h1-3,12-13,15,17-18,20,26,29H,4-11,14,16H2,(H,27,28) |
| InChIKey | YCZGCQDVCQWUFF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |