C24H33Cl2N5O2 — CID 123854526
2-[[4-[[5-chloro-4-[2-chloro-5-(oxan-4-ylmethylamino)-3-pyridinyl]-2-pyridinyl]amino]cyclohexyl]amino]ethanol (PubChem CID 123854526) has the molecular formula C24H33Cl2N5O2 and a molecular weight of 494.47 g/mol. Its IUPAC name is 2-[[4-[[5-chloro-4-[2-chloro-5-(oxan-4-ylmethylamino)-3-pyridinyl]-2-pyridinyl]amino]cyclohexyl]amino]ethanol.
| Compound Name | 2-[[4-[[5-chloro-4-[2-chloro-5-(oxan-4-ylmethylamino)-3-pyridinyl]-2-pyridinyl]amino]cyclohexyl]amino]ethanol |
|---|---|
| PubChem CID | 123854526 |
| Molecular Formula | C24H33Cl2N5O2 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-[[4-[[5-chloro-4-[2-chloro-5-(oxan-4-ylmethylamino)-3-pyridinyl]-2-pyridinyl]amino]cyclohexyl]amino]ethanol |
| SMILES | OCCNC1CCC(Nc2cc(-c3cc(NCC4CCOCC4)cnc3Cl)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C24H33Cl2N5O2/c25-22-15-29-23(31-18-3-1-17(2-4-18)27-7-8-32)12-20(22)21-11-19(14-30-24(21)26)28-13-16-5-9-33-10-6-16/h11-12,14-18,27-28,32H,1-10,13H2,(H,29,31) |
| InChIKey | NSXZWICIQBWUOU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 91.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|