C21H25BrF3NO2 — CID 67638292
(3R,4R)-3-[(4-methoxyphenoxy)methyl]-4-phenyl-1-(1,1,2-trifluoroethyl)piperidine;hydrobromide (PubChem CID 67638292) has the molecular formula C21H25BrF3NO2 and a molecular weight of 460.33 g/mol. Its IUPAC name is (3R,4R)-3-[(4-methoxyphenoxy)methyl]-4-phenyl-1-(1,1,2-trifluoroethyl)piperidine;hydrobromide.
| Compound Name | (3R,4R)-3-[(4-methoxyphenoxy)methyl]-4-phenyl-1-(1,1,2-trifluoroethyl)piperidine;hydrobromide |
|---|---|
| PubChem CID | 67638292 |
| Molecular Formula | C21H25BrF3NO2 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | (3R,4R)-3-[(4-methoxyphenoxy)methyl]-4-phenyl-1-(1,1,2-trifluoroethyl)piperidine;hydrobromide |
| SMILES | Br.COc1ccc(OC[C@H]2CN(C(F)(F)CF)CC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24F3NO2.BrH/c1-26-18-7-9-19(10-8-18)27-14-17-13-25(21(23,24)15-22)12-11-20(17)16-5-3-2-4-6-16;/h2-10,17,20H,11-15H2,1H3;1H/t17-,20+;/m1./s1 |
| InChIKey | MNRPOZVUHNGNPE-XLCHORMMSA-N |
| XLogP | 5.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|