C21H29FN2O3 — CID 67640527
3-[4-[4-(4-fluorophenyl)-4-oxobutyl]piperazin-1-yl]cyclohexane-1-carboxylic acid (PubChem CID 67640527) has the molecular formula C21H29FN2O3 and a molecular weight of 376.47 g/mol. Its IUPAC name is 3-[4-[4-(4-fluorophenyl)-4-oxobutyl]piperazin-1-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[4-[4-(4-fluorophenyl)-4-oxobutyl]piperazin-1-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67640527 |
| Molecular Formula | C21H29FN2O3 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 3-[4-[4-(4-fluorophenyl)-4-oxobutyl]piperazin-1-yl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CCCN1CCN(C2CCCC(C(=O)O)C2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H29FN2O3/c22-18-8-6-16(7-9-18)20(25)5-2-10-23-11-13-24(14-12-23)19-4-1-3-17(15-19)21(26)27/h6-9,17,19H,1-5,10-15H2,(H,26,27) |
| InChIKey | SNAMGUZHLKDXKT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |