C16H30O3Si — CID 67640795
[(1S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methylcyclohex-3-en-1-yl]methyl acetate (PubChem CID 67640795) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is [(1S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methylcyclohex-3-en-1-yl]methyl acetate.
| Compound Name | [(1S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methylcyclohex-3-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 67640795 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [(1S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methylcyclohex-3-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(O[Si](C)(C)C(C)(C)C)CC=CC[C@H]1C |
| InChI | InChI=1S/C16H30O3Si/c1-13-10-8-9-11-16(13,12-18-14(2)17)19-20(6,7)15(3,4)5/h8-9,13H,10-12H2,1-7H3/t13-,16-/m1/s1 |
| InChIKey | HQXLGIWWDUSBTN-CZUORRHYSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|