C9H13ClO — CID 131018953
1-[(1R,6S)-1-chloro-6-methylcyclohex-3-en-1-yl]ethanone (PubChem CID 131018953) has the molecular formula C9H13ClO and a molecular weight of 172.66 g/mol. Its IUPAC name is 1-[(1R,6S)-1-chloro-6-methylcyclohex-3-en-1-yl]ethanone.
| Compound Name | 1-[(1R,6S)-1-chloro-6-methylcyclohex-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 131018953 |
| Molecular Formula | C9H13ClO |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1-[(1R,6S)-1-chloro-6-methylcyclohex-3-en-1-yl]ethanone |
| SMILES | CC(=O)[C@@]1(Cl)CC=CC[C@@H]1C |
| InChI | InChI=1S/C9H13ClO/c1-7-5-3-4-6-9(7,10)8(2)11/h3-4,7H,5-6H2,1-2H3/t7-,9+/m0/s1 |
| InChIKey | PVUWDSKGOAYBIS-IONNQARKSA-N |
| XLogP | 2.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|