C18H28N4O3 — CID 67645079
4-[(4-ethyl-1-piperidin-4-ylimidazole-2-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 67645079) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-[(4-ethyl-1-piperidin-4-ylimidazole-2-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(4-ethyl-1-piperidin-4-ylimidazole-2-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67645079 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 4-[(4-ethyl-1-piperidin-4-ylimidazole-2-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | CCc1cn(C2CCNCC2)c(C(=O)NC2CCC(C(=O)O)CC2)n1 |
| InChI | InChI=1S/C18H28N4O3/c1-2-13-11-22(15-7-9-19-10-8-15)16(20-13)17(23)21-14-5-3-12(4-6-14)18(24)25/h11-12,14-15,19H,2-10H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | CVSWNOFSOROYAO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |