C13H20N4O3S — CID 114611940
N-cyclopropyl-1-piperidin-4-yl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 114611940) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-cyclopropyl-1-piperidin-4-yl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-cyclopropyl-1-piperidin-4-yl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114611940 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-cyclopropyl-1-piperidin-4-yl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NC2CC2)n(C2CCNCC2)c1 |
| InChI | InChI=1S/C13H20N4O3S/c14-21(19,20)11-7-12(13(18)16-9-1-2-9)17(8-11)10-3-5-15-6-4-10/h7-10,15H,1-6H2,(H,16,18)(H2,14,19,20) |
| InChIKey | QZNSJXCTTWQBRL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |