C11H16N2O4S — CID 114612610
methyl 1-cyclopentyl-4-sulfamoylpyrrole-2-carboxylate (PubChem CID 114612610) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is methyl 1-cyclopentyl-4-sulfamoylpyrrole-2-carboxylate.
| Compound Name | methyl 1-cyclopentyl-4-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114612610 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | methyl 1-cyclopentyl-4-sulfamoylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)cn1C1CCCC1 |
| InChI | InChI=1S/C11H16N2O4S/c1-17-11(14)10-6-9(18(12,15)16)7-13(10)8-4-2-3-5-8/h6-8H,2-5H2,1H3,(H2,12,15,16) |
| InChIKey | PZHQZZUUKAKJRD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |