C10H14N2O4S — CID 114612607
methyl 1-cyclobutyl-4-sulfamoylpyrrole-2-carboxylate (PubChem CID 114612607) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is methyl 1-cyclobutyl-4-sulfamoylpyrrole-2-carboxylate.
| Compound Name | methyl 1-cyclobutyl-4-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114612607 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | methyl 1-cyclobutyl-4-sulfamoylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)cn1C1CCC1 |
| InChI | InChI=1S/C10H14N2O4S/c1-16-10(13)9-5-8(17(11,14)15)6-12(9)7-3-2-4-7/h5-7H,2-4H2,1H3,(H2,11,14,15) |
| InChIKey | UFILQMGXIKVKPU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |