C13H18N2O5S — CID 114612767
oxolan-3-yl 1-cyclobutyl-4-sulfamoylpyrrole-2-carboxylate (PubChem CID 114612767) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is oxolan-3-yl 1-cyclobutyl-4-sulfamoylpyrrole-2-carboxylate.
| Compound Name | oxolan-3-yl 1-cyclobutyl-4-sulfamoylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114612767 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | oxolan-3-yl 1-cyclobutyl-4-sulfamoylpyrrole-2-carboxylate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OC2CCOC2)n(C2CCC2)c1 |
| InChI | InChI=1S/C13H18N2O5S/c14-21(17,18)11-6-12(15(7-11)9-2-1-3-9)13(16)20-10-4-5-19-8-10/h6-7,9-10H,1-5,8H2,(H2,14,17,18) |
| InChIKey | ZOVAYSPTAOHMKV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |