C11H13F3N2O4S — CID 114612758
cyclobutyl 4-sulfamoyl-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate (PubChem CID 114612758) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is cyclobutyl 4-sulfamoyl-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate.
| Compound Name | cyclobutyl 4-sulfamoyl-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114612758 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | cyclobutyl 4-sulfamoyl-1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OC2CCC2)n(CC(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O4S/c12-11(13,14)6-16-5-8(21(15,18)19)4-9(16)10(17)20-7-2-1-3-7/h4-5,7H,1-3,6H2,(H2,15,18,19) |
| InChIKey | FWUOFOHYHRYIFK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |