C8H11N3O3S — CID 114612010
1-cyclopropyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 114612010) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 1-cyclopropyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | 1-cyclopropyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114612010 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 1-cyclopropyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | NC(=O)c1cc(S(N)(=O)=O)cn1C1CC1 |
| InChI | InChI=1S/C8H11N3O3S/c9-8(12)7-3-6(15(10,13)14)4-11(7)5-1-2-5/h3-5H,1-2H2,(H2,9,12)(H2,10,13,14) |
| InChIKey | ILSLQWWITCEFBP-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |