C14H23N3O3S — CID 114612118
1-cyclopropyl-N-propan-2-yl-N-propyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 114612118) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-cyclopropyl-N-propan-2-yl-N-propyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | 1-cyclopropyl-N-propan-2-yl-N-propyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114612118 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-cyclopropyl-N-propan-2-yl-N-propyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | CCCN(C(=O)c1cc(S(N)(=O)=O)cn1C1CC1)C(C)C |
| InChI | InChI=1S/C14H23N3O3S/c1-4-7-16(10(2)3)14(18)13-8-12(21(15,19)20)9-17(13)11-5-6-11/h8-11H,4-7H2,1-3H3,(H2,15,19,20) |
| InChIKey | JZHXZWNCBSBZNV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |