C17H14F3N3O2S — CID 67645514
N-[1-methyl-4-phenyl-5-(trifluoromethyl)pyrazol-3-yl]benzenesulfonamide (PubChem CID 67645514) has the molecular formula C17H14F3N3O2S and a molecular weight of 381.38 g/mol. Its IUPAC name is N-[1-methyl-4-phenyl-5-(trifluoromethyl)pyrazol-3-yl]benzenesulfonamide.
| Compound Name | N-[1-methyl-4-phenyl-5-(trifluoromethyl)pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67645514 |
| Molecular Formula | C17H14F3N3O2S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-[1-methyl-4-phenyl-5-(trifluoromethyl)pyrazol-3-yl]benzenesulfonamide |
| SMILES | Cn1nc(NS(=O)(=O)c2ccccc2)c(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C17H14F3N3O2S/c1-23-15(17(18,19)20)14(12-8-4-2-5-9-12)16(21-23)22-26(24,25)13-10-6-3-7-11-13/h2-11H,1H3,(H,21,22) |
| InChIKey | OSOKLVGLMGKFAS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |