C13H11LiNO5 — CID 67646015
CID 67646015 (PubChem CID 67646015) has the molecular formula C13H11LiNO5 and a molecular weight of 268.17 g/mol.
| Compound Name | CID 67646015 |
|---|---|
| PubChem CID | 67646015 |
| Molecular Formula | C13H11LiNO5 |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | — |
| SMILES | O=C(O)C(O)(Cc1ccc2ccccc2n1)C(=O)O.[Li] |
| InChI | InChI=1S/C13H11NO5.Li/c15-11(16)13(19,12(17)18)7-9-6-5-8-3-1-2-4-10(8)14-9;/h1-6,19H,7H2,(H,15,16)(H,17,18); |
| InChIKey | MMSRPPMUKCUHFK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|