C16H10Cl2F3N3O2S — CID 67647633
2-[5-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 67647633) has the molecular formula C16H10Cl2F3N3O2S and a molecular weight of 436.24 g/mol. Its IUPAC name is 2-[5-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | 2-[5-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67647633 |
| Molecular Formula | C16H10Cl2F3N3O2S |
| Molecular Weight | 436.24 g/mol |
| Exact Mass | 434.98 |
| IUPAC Name | 2-[5-(2,5-dichlorophenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-n1nc(C(F)(F)F)cc1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H10Cl2F3N3O2S/c17-9-5-6-11(18)10(7-9)13-8-15(16(19,20)21)23-24(13)12-3-1-2-4-14(12)27(22,25)26/h1-8H,(H2,22,25,26) |
| InChIKey | NSORVQGUDZCQMX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |