C18H19ClN4O4S2 — CID 67647700
5-(4-chlorophenyl)-N-ethyl-N-methyl-1-(2-sulfamoylphenyl)pyrazole-3-sulfonamide (PubChem CID 67647700) has the molecular formula C18H19ClN4O4S2 and a molecular weight of 454.96 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-ethyl-N-methyl-1-(2-sulfamoylphenyl)pyrazole-3-sulfonamide.
| Compound Name | 5-(4-chlorophenyl)-N-ethyl-N-methyl-1-(2-sulfamoylphenyl)pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 67647700 |
| Molecular Formula | C18H19ClN4O4S2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 5-(4-chlorophenyl)-N-ethyl-N-methyl-1-(2-sulfamoylphenyl)pyrazole-3-sulfonamide |
| SMILES | CCN(C)S(=O)(=O)c1cc(-c2ccc(Cl)cc2)n(-c2ccccc2S(N)(=O)=O)n1 |
| InChI | InChI=1S/C18H19ClN4O4S2/c1-3-22(2)29(26,27)18-12-16(13-8-10-14(19)11-9-13)23(21-18)15-6-4-5-7-17(15)28(20,24)25/h4-12H,3H2,1-2H3,(H2,20,24,25) |
| InChIKey | MJEWODJHSCETDJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |