C38H50ClN5O4 — CID 67652200
N-[2-(3-chlorophenyl)-4-[4-(1-pentylbenzimidazol-2-yl)-1,4-diazepan-1-yl]butyl]-2,3,4-trimethoxy-N-methylbenzamide (PubChem CID 67652200) has the molecular formula C38H50ClN5O4 and a molecular weight of 676.30 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-4-[4-(1-pentylbenzimidazol-2-yl)-1,4-diazepan-1-yl]butyl]-2,3,4-trimethoxy-N-methylbenzamide.
| Compound Name | N-[2-(3-chlorophenyl)-4-[4-(1-pentylbenzimidazol-2-yl)-1,4-diazepan-1-yl]butyl]-2,3,4-trimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 67652200 |
| Molecular Formula | C38H50ClN5O4 |
| Molecular Weight | 676.30 g/mol |
| Exact Mass | 675.36 |
| IUPAC Name | N-[2-(3-chlorophenyl)-4-[4-(1-pentylbenzimidazol-2-yl)-1,4-diazepan-1-yl]butyl]-2,3,4-trimethoxy-N-methylbenzamide |
| SMILES | CCCCCn1c(N2CCCN(CCC(CN(C)C(=O)c3ccc(OC)c(OC)c3OC)c3cccc(Cl)c3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C38H50ClN5O4/c1-6-7-10-22-44-33-16-9-8-15-32(33)40-38(44)43-21-12-20-42(24-25-43)23-19-29(28-13-11-14-30(39)26-28)27-41(2)37(45)31-17-18-34(46-3)36(48-5)35(31)47-4/h8-9,11,13-18,26,29H,6-7,10,12,19-25,27H2,1-5H3 |
| InChIKey | TTWQABOMEZAWSI-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.30 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|