C22H18O8 — CID 67653524
(3,5-dihydroxyphenyl) 2-[3-[2-(3,5-dihydroxyphenoxy)-2-oxoethyl]phenyl]acetate (PubChem CID 67653524) has the molecular formula C22H18O8 and a molecular weight of 410.38 g/mol. Its IUPAC name is (3,5-dihydroxyphenyl) 2-[3-[2-(3,5-dihydroxyphenoxy)-2-oxoethyl]phenyl]acetate.
| Compound Name | (3,5-dihydroxyphenyl) 2-[3-[2-(3,5-dihydroxyphenoxy)-2-oxoethyl]phenyl]acetate |
|---|---|
| PubChem CID | 67653524 |
| Molecular Formula | C22H18O8 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (3,5-dihydroxyphenyl) 2-[3-[2-(3,5-dihydroxyphenoxy)-2-oxoethyl]phenyl]acetate |
| SMILES | O=C(Cc1cccc(CC(=O)Oc2cc(O)cc(O)c2)c1)Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C22H18O8/c23-15-7-16(24)10-19(9-15)29-21(27)5-13-2-1-3-14(4-13)6-22(28)30-20-11-17(25)8-18(26)12-20/h1-4,7-12,23-26H,5-6H2 |
| InChIKey | CUBSOZWWNUGVOE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|