C20H23N3O4 — CID 67655452
2-(3-methylphenoxy)-2-[(4-piperazin-1-ylbenzoyl)amino]acetic acid (PubChem CID 67655452) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-2-[(4-piperazin-1-ylbenzoyl)amino]acetic acid.
| Compound Name | 2-(3-methylphenoxy)-2-[(4-piperazin-1-ylbenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 67655452 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-(3-methylphenoxy)-2-[(4-piperazin-1-ylbenzoyl)amino]acetic acid |
| SMILES | Cc1cccc(OC(NC(=O)c2ccc(N3CCNCC3)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-14-3-2-4-17(13-14)27-19(20(25)26)22-18(24)15-5-7-16(8-6-15)23-11-9-21-10-12-23/h2-8,13,19,21H,9-12H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | SXEQSMLOOLOHEV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|