C27H38F2O6S — CID 67657446
3-[[(8S,9S,10S,13S,14S)-17-(1,1-dihydroxybutyl)-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]sulfanyl]oxolan-2-one (PubChem CID 67657446) has the molecular formula C27H38F2O6S and a molecular weight of 528.66 g/mol. Its IUPAC name is 3-[[(8S,9S,10S,13S,14S)-17-(1,1-dihydroxybutyl)-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]sulfanyl]oxolan-2-one.
| Compound Name | 3-[[(8S,9S,10S,13S,14S)-17-(1,1-dihydroxybutyl)-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]sulfanyl]oxolan-2-one |
|---|---|
| PubChem CID | 67657446 |
| Molecular Formula | C27H38F2O6S |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 3-[[(8S,9S,10S,13S,14S)-17-(1,1-dihydroxybutyl)-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]sulfanyl]oxolan-2-one |
| SMILES | CCCC(O)(O)C1(SC2CCOC2=O)CC[C@H]2[C@@H]3CC(F)C4=CC(=O)CC[C@]4(C)[C@]3(F)C(O)C[C@@]21C |
| InChI | InChI=1S/C27H38F2O6S/c1-4-8-26(33,34)25(36-20-7-11-35-22(20)32)10-6-16-17-13-19(28)18-12-15(30)5-9-23(18,2)27(17,29)21(31)14-24(16,25)3/h12,16-17,19-21,31,33-34H,4-11,13-14H2,1-3H3/t16-,17-,19?,20?,21?,23-,24-,25?,27+/m0/s1 |
| InChIKey | IDLLVISJDQZMHB-MIVUFTHUSA-N |
| XLogP | 3.80 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|