C21H28F2O4 — CID 67895390
(8S,9R,10S,13S,14S,17R)-17-acetyl-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67895390) has the molecular formula C21H28F2O4 and a molecular weight of 382.45 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,17R)-17-acetyl-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,13S,14S,17R)-17-acetyl-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67895390 |
| Molecular Formula | C21H28F2O4 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (8S,9R,10S,13S,14S,17R)-17-acetyl-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CC(F)C4=CC(=O)CC[C@]4(C)[C@@]3(F)C(O)C[C@@]21C |
| InChI | InChI=1S/C21H28F2O4/c1-11(24)20(27)7-5-13-14-9-16(22)15-8-12(25)4-6-18(15,2)21(14,23)17(26)10-19(13,20)3/h8,13-14,16-17,26-27H,4-7,9-10H2,1-3H3/t13-,14-,16?,17?,18-,19-,20-,21-/m0/s1 |
| InChIKey | OIZVFUWNHYXWFG-ANLHFJCUSA-N |
| XLogP | 2.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |