C30H55O3P — CID 67658344
[2-[5-ethyl-7-(2-ethylhexyl)tetradecan-7-yl]phenyl] dihydrogen phosphite (PubChem CID 67658344) has the molecular formula C30H55O3P and a molecular weight of 494.74 g/mol. Its IUPAC name is [2-[5-ethyl-7-(2-ethylhexyl)tetradecan-7-yl]phenyl] dihydrogen phosphite.
| Compound Name | [2-[5-ethyl-7-(2-ethylhexyl)tetradecan-7-yl]phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 67658344 |
| Molecular Formula | C30H55O3P |
| Molecular Weight | 494.74 g/mol |
| Exact Mass | 494.39 |
| IUPAC Name | [2-[5-ethyl-7-(2-ethylhexyl)tetradecan-7-yl]phenyl] dihydrogen phosphite |
| SMILES | CCCCCCCC(CC(CC)CCCC)(CC(CC)CCCC)c1ccccc1OP(O)O |
| InChI | InChI=1S/C30H55O3P/c1-6-11-14-15-18-23-30(24-26(9-4)19-12-7-2,25-27(10-5)20-13-8-3)28-21-16-17-22-29(28)33-34(31)32/h16-17,21-22,26-27,31-32H,6-15,18-20,23-25H2,1-5H3 |
| InChIKey | CPHINHHGUPHMNW-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.74 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|