About diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite
diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite (PubChem CID 161432608) has the molecular formula C20H30O6P2
and a molecular weight of 428.40 g/mol. Its IUPAC name is diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite.
Molecular Properties
| Compound Name | diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite |
| PubChem CID | 161432608 |
| Molecular Formula | C20H30O6P2 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite |
| SMILES | CCCCC(CC)COP(O)O.OP(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C12H11O3P.C8H19O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12;1-3-5-6-8(4-2)7-11-12(9)10/h1-10,13H;8-10H,3-7H2,1-2H3 |
| InChIKey | VYFJYANOHVLIQQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite?
The IUPAC name of diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite (CID 161432608) is diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite.
What is the SMILES notation for diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite?
The canonical SMILES for diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite is CCCCC(CC)COP(O)O.OP(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite?
The InChIKey is VYFJYANOHVLIQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11O3P.C8H19O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12;1-3-5-6-8(4-2)7-11-12(9)10/h1-10,13H;8-10H,3-7H2,1-2H3.
What are the key properties of diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite?
diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite has a molecular weight of 428.40 g/mol, XLogP of 5.79, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl hydrogen phosphite;2-ethylhexyl dihydrogen phosphite is sourced from PubChem (CID 161432608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).