C20H28O6P2 — CID 174771557
[2-ethylhexoxy(hydroxy)phosphanyl] diphenyl phosphate (PubChem CID 174771557) has the molecular formula C20H28O6P2 and a molecular weight of 426.39 g/mol. Its IUPAC name is [2-ethylhexoxy(hydroxy)phosphanyl] diphenyl phosphate.
| Compound Name | [2-ethylhexoxy(hydroxy)phosphanyl] diphenyl phosphate |
|---|---|
| PubChem CID | 174771557 |
| Molecular Formula | C20H28O6P2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | [2-ethylhexoxy(hydroxy)phosphanyl] diphenyl phosphate |
| SMILES | CCCCC(CC)COP(O)OP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C20H28O6P2/c1-3-5-12-18(4-2)17-23-27(21)26-28(22,24-19-13-8-6-9-14-19)25-20-15-10-7-11-16-20/h6-11,13-16,18,21H,3-5,12,17H2,1-2H3 |
| InChIKey | JPIAKYPONWTXEX-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|