C26H32N2O3 — CID 67660167
methyl 4-[4-methoxy-3-[[(2-phenylpiperidin-1-yl)amino]methyl]phenyl]-4-methylpent-2-ynoate (PubChem CID 67660167) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is methyl 4-[4-methoxy-3-[[(2-phenylpiperidin-1-yl)amino]methyl]phenyl]-4-methylpent-2-ynoate.
| Compound Name | methyl 4-[4-methoxy-3-[[(2-phenylpiperidin-1-yl)amino]methyl]phenyl]-4-methylpent-2-ynoate |
|---|---|
| PubChem CID | 67660167 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | methyl 4-[4-methoxy-3-[[(2-phenylpiperidin-1-yl)amino]methyl]phenyl]-4-methylpent-2-ynoate |
| SMILES | COC(=O)C#CC(C)(C)c1ccc(OC)c(CNN2CCCCC2c2ccccc2)c1 |
| InChI | InChI=1S/C26H32N2O3/c1-26(2,16-15-25(29)31-4)22-13-14-24(30-3)21(18-22)19-27-28-17-9-8-12-23(28)20-10-6-5-7-11-20/h5-7,10-11,13-14,18,23,27H,8-9,12,17,19H2,1-4H3 |
| InChIKey | VMMSVVAFRYVOAN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|