C25H29F3N2O — CID 70211297
(2S,3S)-3-[[2-methoxy-5-(5,5,5-trifluoro-2-methylpent-3-yn-2-yl)phenyl]methyl]-2-phenylpiperidin-1-amine (PubChem CID 70211297) has the molecular formula C25H29F3N2O and a molecular weight of 430.51 g/mol. Its IUPAC name is (2S,3S)-3-[[2-methoxy-5-(5,5,5-trifluoro-2-methylpent-3-yn-2-yl)phenyl]methyl]-2-phenylpiperidin-1-amine.
| Compound Name | (2S,3S)-3-[[2-methoxy-5-(5,5,5-trifluoro-2-methylpent-3-yn-2-yl)phenyl]methyl]-2-phenylpiperidin-1-amine |
|---|---|
| PubChem CID | 70211297 |
| Molecular Formula | C25H29F3N2O |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2S,3S)-3-[[2-methoxy-5-(5,5,5-trifluoro-2-methylpent-3-yn-2-yl)phenyl]methyl]-2-phenylpiperidin-1-amine |
| SMILES | COc1ccc(C(C)(C)C#CC(F)(F)F)cc1C[C@@H]1CCCN(N)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H29F3N2O/c1-24(2,13-14-25(26,27)28)21-11-12-22(31-3)20(17-21)16-19-10-7-15-30(29)23(19)18-8-5-4-6-9-18/h4-6,8-9,11-12,17,19,23H,7,10,15-16,29H2,1-3H3/t19-,23+/m0/s1 |
| InChIKey | LBSMOUMVZBVTJR-WMZHIEFXSA-N |
| XLogP | 5.41 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|