C23H29Cl2F2N3O2 — CID 172724889
7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-1-(difluoromethyl)-6-methoxy-3,4-dihydroquinolin-2-one;dihydrochloride (PubChem CID 172724889) has the molecular formula C23H29Cl2F2N3O2 and a molecular weight of 488.41 g/mol. Its IUPAC name is 7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-1-(difluoromethyl)-6-methoxy-3,4-dihydroquinolin-2-one;dihydrochloride.
| Compound Name | 7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-1-(difluoromethyl)-6-methoxy-3,4-dihydroquinolin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 172724889 |
| Molecular Formula | C23H29Cl2F2N3O2 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-1-(difluoromethyl)-6-methoxy-3,4-dihydroquinolin-2-one;dihydrochloride |
| SMILES | COc1cc2c(cc1C[C@@H]1CCCN(N)[C@@H]1c1ccccc1)N(C(F)F)C(=O)CC2.Cl.Cl |
| InChI | InChI=1S/C23H27F2N3O2.2ClH/c1-30-20-14-16-9-10-21(29)28(23(24)25)19(16)13-18(20)12-17-8-5-11-27(26)22(17)15-6-3-2-4-7-15;;/h2-4,6-7,13-14,17,22-23H,5,8-12,26H2,1H3;2*1H/t17-,22+;;/m0../s1 |
| InChIKey | GZYUUQUCWLUEOR-HVDCVHHPSA-N |
| XLogP | 4.91 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|