C24H32N2O2 — CID 150999414
3-[3-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-4-methoxyphenyl]-3-methylbutan-2-one (PubChem CID 150999414) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is 3-[3-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-4-methoxyphenyl]-3-methylbutan-2-one.
| Compound Name | 3-[3-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-4-methoxyphenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 150999414 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 3-[3-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-4-methoxyphenyl]-3-methylbutan-2-one |
| SMILES | COc1ccc(C(C)(C)C(C)=O)cc1C[C@@H]1CCCN(N)C1c1ccccc1 |
| InChI | InChI=1S/C24H32N2O2/c1-17(27)24(2,3)21-12-13-22(28-4)20(16-21)15-19-11-8-14-26(25)23(19)18-9-6-5-7-10-18/h5-7,9-10,12-13,16,19,23H,8,11,14-15,25H2,1-4H3/t19-,23?/m0/s1 |
| InChIKey | LTUBWHGQNWXOHL-HSTJUUNISA-N |
| XLogP | 4.43 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|