C22H26Cl2F6N2O2 — CID 172722423
2-[3-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-4-methoxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;dihydrochloride (PubChem CID 172722423) has the molecular formula C22H26Cl2F6N2O2 and a molecular weight of 535.36 g/mol. Its IUPAC name is 2-[3-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-4-methoxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;dihydrochloride.
| Compound Name | 2-[3-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-4-methoxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 172722423 |
| Molecular Formula | C22H26Cl2F6N2O2 |
| Molecular Weight | 535.36 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 2-[3-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-4-methoxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;dihydrochloride |
| SMILES | COc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1C[C@@H]1CCCN(N)[C@@H]1c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C22H24F6N2O2.2ClH/c1-32-18-10-9-17(20(31,21(23,24)25)22(26,27)28)13-16(18)12-15-8-5-11-30(29)19(15)14-6-3-2-4-7-14;;/h2-4,6-7,9-10,13,15,19,31H,5,8,11-12,29H2,1H3;2*1H/t15-,19+;;/m0../s1 |
| InChIKey | GRUAMEMYTBYWAV-GMWJYZTKSA-N |
| XLogP | 5.72 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.36 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|