C24H31N3O2 — CID 160723313
7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-6-methoxy-1,3-dimethyl-3,4-dihydroquinolin-2-one (PubChem CID 160723313) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-6-methoxy-1,3-dimethyl-3,4-dihydroquinolin-2-one.
| Compound Name | 7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-6-methoxy-1,3-dimethyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 160723313 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-6-methoxy-1,3-dimethyl-3,4-dihydroquinolin-2-one |
| SMILES | COc1cc2c(cc1C[C@@H]1CCCN(N)[C@@H]1c1ccccc1)N(C)C(=O)C(C)C2 |
| InChI | InChI=1S/C24H31N3O2/c1-16-12-19-15-22(29-3)20(14-21(19)26(2)24(16)28)13-18-10-7-11-27(25)23(18)17-8-5-4-6-9-17/h4-6,8-9,14-16,18,23H,7,10-13,25H2,1-3H3/t16?,18-,23+/m0/s1 |
| InChIKey | RTJOAOVWWYCXOE-ZYTBWDKESA-N |
| XLogP | 3.72 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|