C20H26N2O3S — CID 70200187
(2R,3R)-3-[(2-methoxy-5-methylsulfonylphenyl)methyl]-2-phenylpiperidin-1-amine (PubChem CID 70200187) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is (2R,3R)-3-[(2-methoxy-5-methylsulfonylphenyl)methyl]-2-phenylpiperidin-1-amine.
| Compound Name | (2R,3R)-3-[(2-methoxy-5-methylsulfonylphenyl)methyl]-2-phenylpiperidin-1-amine |
|---|---|
| PubChem CID | 70200187 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (2R,3R)-3-[(2-methoxy-5-methylsulfonylphenyl)methyl]-2-phenylpiperidin-1-amine |
| SMILES | COc1ccc(S(C)(=O)=O)cc1C[C@H]1CCCN(N)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H26N2O3S/c1-25-19-11-10-18(26(2,23)24)14-17(19)13-16-9-6-12-22(21)20(16)15-7-4-3-5-8-15/h3-5,7-8,10-11,14,16,20H,6,9,12-13,21H2,1-2H3/t16-,20+/m1/s1 |
| InChIKey | JCYMCKHAYPBQHY-UZLBHIALSA-N |
| XLogP | 2.97 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|