C29H37N3O3S — CID 67851355
N-[3-[(1-amino-2-phenylpiperidin-3-yl)methyl]-4-propan-2-yloxyphenyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 67851355) has the molecular formula C29H37N3O3S and a molecular weight of 507.70 g/mol. Its IUPAC name is N-[3-[(1-amino-2-phenylpiperidin-3-yl)methyl]-4-propan-2-yloxyphenyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[3-[(1-amino-2-phenylpiperidin-3-yl)methyl]-4-propan-2-yloxyphenyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 67851355 |
| Molecular Formula | C29H37N3O3S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | N-[3-[(1-amino-2-phenylpiperidin-3-yl)methyl]-4-propan-2-yloxyphenyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(OC(C)C)c(CC3CCCN(N)C3c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H37N3O3S/c1-21(2)35-28-17-14-26(31(4)36(33,34)27-15-12-22(3)13-16-27)20-25(28)19-24-11-8-18-32(30)29(24)23-9-6-5-7-10-23/h5-7,9-10,12-17,20-21,24,29H,8,11,18-19,30H2,1-4H3 |
| InChIKey | DIBAGWWIXQGQMW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|