C19H22ClFN2O — CID 174272241
(2R,3R)-3-[(5-chloro-2-methoxyphenyl)methyl]-2-(3-fluorophenyl)piperidin-1-amine (PubChem CID 174272241) has the molecular formula C19H22ClFN2O and a molecular weight of 348.85 g/mol. Its IUPAC name is (2R,3R)-3-[(5-chloro-2-methoxyphenyl)methyl]-2-(3-fluorophenyl)piperidin-1-amine.
| Compound Name | (2R,3R)-3-[(5-chloro-2-methoxyphenyl)methyl]-2-(3-fluorophenyl)piperidin-1-amine |
|---|---|
| PubChem CID | 174272241 |
| Molecular Formula | C19H22ClFN2O |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (2R,3R)-3-[(5-chloro-2-methoxyphenyl)methyl]-2-(3-fluorophenyl)piperidin-1-amine |
| SMILES | COc1ccc(Cl)cc1C[C@H]1CCCN(N)[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C19H22ClFN2O/c1-24-18-8-7-16(20)11-15(18)10-13-5-3-9-23(22)19(13)14-4-2-6-17(21)12-14/h2,4,6-8,11-13,19H,3,5,9-10,22H2,1H3/t13-,19-/m1/s1 |
| InChIKey | BXVLJKVMKTVQPF-BFUOFWGJSA-N |
| XLogP | 4.36 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|