C20H23ClN2O — CID 67585503
(2S,3S)-3-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine (PubChem CID 67585503) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is (2S,3S)-3-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine.
| Compound Name | (2S,3S)-3-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine |
|---|---|
| PubChem CID | 67585503 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (2S,3S)-3-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine |
| SMILES | NN1CCC[C@@H](Cc2cc(Cl)cc3c2OCC3)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H23ClN2O/c21-18-12-16-8-10-24-20(16)17(13-18)11-15-7-4-9-23(22)19(15)14-5-2-1-3-6-14/h1-3,5-6,12-13,15,19H,4,7-11,22H2/t15-,19+/m0/s1 |
| InChIKey | AOVRSOJWKCYKLK-HNAYVOBHSA-N |
| XLogP | 4.14 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|