C23H30N2O — CID 67585248
(2S,3S)-2-phenyl-3-[(5-propan-2-yl-2,3-dihydro-1-benzofuran-7-yl)methyl]piperidin-1-amine (PubChem CID 67585248) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is (2S,3S)-2-phenyl-3-[(5-propan-2-yl-2,3-dihydro-1-benzofuran-7-yl)methyl]piperidin-1-amine.
| Compound Name | (2S,3S)-2-phenyl-3-[(5-propan-2-yl-2,3-dihydro-1-benzofuran-7-yl)methyl]piperidin-1-amine |
|---|---|
| PubChem CID | 67585248 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (2S,3S)-2-phenyl-3-[(5-propan-2-yl-2,3-dihydro-1-benzofuran-7-yl)methyl]piperidin-1-amine |
| SMILES | CC(C)c1cc2c(c(C[C@@H]3CCCN(N)[C@@H]3c3ccccc3)c1)OCC2 |
| InChI | InChI=1S/C23H30N2O/c1-16(2)20-14-19-10-12-26-23(19)21(15-20)13-18-9-6-11-25(24)22(18)17-7-4-3-5-8-17/h3-5,7-8,14-16,18,22H,6,9-13,24H2,1-2H3/t18-,22+/m0/s1 |
| InChIKey | UMHHARIWDZZQBL-PGRDOPGGSA-N |
| XLogP | 4.61 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|