C28H26F6N2O — CID 157228178
(2S,3S)-3-[[5-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-7-yl]methyl]-2-phenylpiperidin-1-amine (PubChem CID 157228178) has the molecular formula C28H26F6N2O and a molecular weight of 520.52 g/mol. Its IUPAC name is (2S,3S)-3-[[5-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-7-yl]methyl]-2-phenylpiperidin-1-amine.
| Compound Name | (2S,3S)-3-[[5-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-7-yl]methyl]-2-phenylpiperidin-1-amine |
|---|---|
| PubChem CID | 157228178 |
| Molecular Formula | C28H26F6N2O |
| Molecular Weight | 520.52 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | (2S,3S)-3-[[5-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro-1-benzofuran-7-yl]methyl]-2-phenylpiperidin-1-amine |
| SMILES | NN1CCC[C@@H](Cc2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc3c2OCC3)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C28H26F6N2O/c29-27(30,31)23-14-21(15-24(16-23)28(32,33)34)20-12-19-8-10-37-26(19)22(13-20)11-18-7-4-9-36(35)25(18)17-5-2-1-3-6-17/h1-3,5-6,12-16,18,25H,4,7-11,35H2/t18-,25+/m0/s1 |
| InChIKey | QYSLLPGALNFFBF-AVRWGWEMSA-N |
| XLogP | 7.20 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.52 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|