C19H22ClF3N2O — CID 69240549
(2S,3S)-2-phenyl-3-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-1-amine;hydrochloride (PubChem CID 69240549) has the molecular formula C19H22ClF3N2O and a molecular weight of 386.85 g/mol. Its IUPAC name is (2S,3S)-2-phenyl-3-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-1-amine;hydrochloride.
| Compound Name | (2S,3S)-2-phenyl-3-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-1-amine;hydrochloride |
|---|---|
| PubChem CID | 69240549 |
| Molecular Formula | C19H22ClF3N2O |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2S,3S)-2-phenyl-3-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-1-amine;hydrochloride |
| SMILES | Cl.NN1CCC[C@@H](Cc2cccc(OC(F)(F)F)c2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H21F3N2O.ClH/c20-19(21,22)25-17-10-4-6-14(13-17)12-16-9-5-11-24(23)18(16)15-7-2-1-3-8-15;/h1-4,6-8,10,13,16,18H,5,9,11-12,23H2;1H/t16-,18+;/m0./s1 |
| InChIKey | JFQBBQHKUOMIMX-KUGOCAJQSA-N |
| XLogP | 4.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|