C18H16F3N3O3S — CID 67662430
2-[5-(4-methoxyphenyl)-4-methyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 67662430) has the molecular formula C18H16F3N3O3S and a molecular weight of 411.41 g/mol. Its IUPAC name is 2-[5-(4-methoxyphenyl)-4-methyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | 2-[5-(4-methoxyphenyl)-4-methyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67662430 |
| Molecular Formula | C18H16F3N3O3S |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 2-[5-(4-methoxyphenyl)-4-methyl-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2c(C)c(C(F)(F)F)nn2-c2ccccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H16F3N3O3S/c1-11-16(12-7-9-13(27-2)10-8-12)24(23-17(11)18(19,20)21)14-5-3-4-6-15(14)28(22,25)26/h3-10H,1-2H3,(H2,22,25,26) |
| InChIKey | IJXYESTVSVFNOE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |