C18H18F3N3O3S — CID 142190526
benzenesulfonamide;5-(4-methoxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole (PubChem CID 142190526) has the molecular formula C18H18F3N3O3S and a molecular weight of 413.42 g/mol. Its IUPAC name is benzenesulfonamide;5-(4-methoxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole.
| Compound Name | benzenesulfonamide;5-(4-methoxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 142190526 |
| Molecular Formula | C18H18F3N3O3S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | benzenesulfonamide;5-(4-methoxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nn2C)cc1.NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H11F3N2O.C6H7NO2S/c1-17-10(7-11(16-17)12(13,14)15)8-3-5-9(18-2)6-4-8;7-10(8,9)6-4-2-1-3-5-6/h3-7H,1-2H3;1-5H,(H2,7,8,9) |
| InChIKey | XZLVPKJURKBGTQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |