C27H34N6O8 — CID 67663218
(E)-but-2-enedioic acid;N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 67663218) has the molecular formula C27H34N6O8 and a molecular weight of 570.60 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | (E)-but-2-enedioic acid;N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 67663218 |
| Molecular Formula | C27H34N6O8 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cc1N1CCN(C)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H30N6O4.C4H4O4/c1-25-9-11-27(12-10-25)21-17-18(3-8-22(21)33-2)24-23(30)28-15-13-26(14-16-28)19-4-6-20(7-5-19)29(31)32;5-3(6)1-2-4(7)8/h3-8,17H,9-16H2,1-2H3,(H,24,30);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ZMTYTTPHENQJRB-WLHGVMLRSA-N |
| XLogP | 2.42 |
| TPSA | 169.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|