C32H37N5O3 — CID 67664742
N-[[[2-[(3-amino-3-methylbutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]methyl]-N-ethyl-2-phenylbenzamide (PubChem CID 67664742) has the molecular formula C32H37N5O3 and a molecular weight of 539.68 g/mol. Its IUPAC name is N-[[[2-[(3-amino-3-methylbutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]methyl]-N-ethyl-2-phenylbenzamide.
| Compound Name | N-[[[2-[(3-amino-3-methylbutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]methyl]-N-ethyl-2-phenylbenzamide |
|---|---|
| PubChem CID | 67664742 |
| Molecular Formula | C32H37N5O3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | N-[[[2-[(3-amino-3-methylbutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]methyl]-N-ethyl-2-phenylbenzamide |
| SMILES | CCN(CNC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CC(C)(C)N)C(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C32H37N5O3/c1-4-37(31(40)26-16-9-8-14-24(26)22-12-6-5-7-13-22)21-35-30(39)28(36-29(38)19-32(2,3)33)18-23-20-34-27-17-11-10-15-25(23)27/h5-17,20,28,34H,4,18-19,21,33H2,1-3H3,(H,35,39)(H,36,38) |
| InChIKey | LPFHXOGCUUJNOD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|