C29H33NO5 — CID 67665514
benzyl 3-hydroxy-4-methyl-2-[1-[4-(phenylmethoxycarbonylamino)phenyl]ethyl]pentanoate (PubChem CID 67665514) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is benzyl 3-hydroxy-4-methyl-2-[1-[4-(phenylmethoxycarbonylamino)phenyl]ethyl]pentanoate.
| Compound Name | benzyl 3-hydroxy-4-methyl-2-[1-[4-(phenylmethoxycarbonylamino)phenyl]ethyl]pentanoate |
|---|---|
| PubChem CID | 67665514 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | benzyl 3-hydroxy-4-methyl-2-[1-[4-(phenylmethoxycarbonylamino)phenyl]ethyl]pentanoate |
| SMILES | CC(C)C(O)C(C(=O)OCc1ccccc1)C(C)c1ccc(NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H33NO5/c1-20(2)27(31)26(28(32)34-18-22-10-6-4-7-11-22)21(3)24-14-16-25(17-15-24)30-29(33)35-19-23-12-8-5-9-13-23/h4-17,20-21,26-27,31H,18-19H2,1-3H3,(H,30,33) |
| InChIKey | UFEZZRLLNMKLSO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |