C24H35FO3Si — CID 67667949
tert-butyl-[[3-[2-[(2-fluorophenyl)methoxy]-2-methylpropoxy]phenyl]methoxy]-dimethylsilane (PubChem CID 67667949) has the molecular formula C24H35FO3Si and a molecular weight of 418.63 g/mol. Its IUPAC name is tert-butyl-[[3-[2-[(2-fluorophenyl)methoxy]-2-methylpropoxy]phenyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[3-[2-[(2-fluorophenyl)methoxy]-2-methylpropoxy]phenyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 67667949 |
| Molecular Formula | C24H35FO3Si |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | tert-butyl-[[3-[2-[(2-fluorophenyl)methoxy]-2-methylpropoxy]phenyl]methoxy]-dimethylsilane |
| SMILES | CC(C)(COc1cccc(CO[Si](C)(C)C(C)(C)C)c1)OCc1ccccc1F |
| InChI | InChI=1S/C24H35FO3Si/c1-23(2,3)29(6,7)28-16-19-11-10-13-21(15-19)26-18-24(4,5)27-17-20-12-8-9-14-22(20)25/h8-15H,16-18H2,1-7H3 |
| InChIKey | ISGQASJSGVCURP-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|