C20H18N2O7S — CID 67669469
2-[1-[(4-nitrophenyl)sulfonylamino]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]prop-2-enoic acid (PubChem CID 67669469) has the molecular formula C20H18N2O7S and a molecular weight of 430.44 g/mol. Its IUPAC name is 2-[1-[(4-nitrophenyl)sulfonylamino]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]prop-2-enoic acid.
| Compound Name | 2-[1-[(4-nitrophenyl)sulfonylamino]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67669469 |
| Molecular Formula | C20H18N2O7S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2-[1-[(4-nitrophenyl)sulfonylamino]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1cccc2c1OC1CCC(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)C21 |
| InChI | InChI=1S/C20H18N2O7S/c1-11(20(23)24)14-3-2-4-15-18-16(9-10-17(18)29-19(14)15)21-30(27,28)13-7-5-12(6-8-13)22(25)26/h2-8,16-18,21H,1,9-10H2,(H,23,24) |
| InChIKey | HRCGEZJYELKYJR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|