C42H53N7O7 — CID 67670836
methyl N-[(2S)-1-[[3-[[(2S)-4-amino-4-oxo-2-(quinoline-2-carbonylamino)butanoyl]amino]-2-butoxy-4-phenylbutyl]-(benzylamino)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 67670836) has the molecular formula C42H53N7O7 and a molecular weight of 767.93 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[3-[[(2S)-4-amino-4-oxo-2-(quinoline-2-carbonylamino)butanoyl]amino]-2-butoxy-4-phenylbutyl]-(benzylamino)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[[3-[[(2S)-4-amino-4-oxo-2-(quinoline-2-carbonylamino)butanoyl]amino]-2-butoxy-4-phenylbutyl]-(benzylamino)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67670836 |
| Molecular Formula | C42H53N7O7 |
| Molecular Weight | 767.93 g/mol |
| Exact Mass | 767.40 |
| IUPAC Name | methyl N-[(2S)-1-[[3-[[(2S)-4-amino-4-oxo-2-(quinoline-2-carbonylamino)butanoyl]amino]-2-butoxy-4-phenylbutyl]-(benzylamino)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCOC(CN(NCc1ccccc1)C(=O)[C@@H](NC(=O)OC)C(C)C)C(Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C42H53N7O7/c1-5-6-23-56-36(27-49(44-26-30-17-11-8-12-18-30)41(53)38(28(2)3)48-42(54)55-4)34(24-29-15-9-7-10-16-29)46-40(52)35(25-37(43)50)47-39(51)33-22-21-31-19-13-14-20-32(31)45-33/h7-22,28,34-36,38,44H,5-6,23-27H2,1-4H3,(H2,43,50)(H,46,52)(H,47,51)(H,48,54)/t34?,35-,36?,38-/m0/s1 |
| InChIKey | OZVTXCQJXIAAST-LTDKDVFVSA-N |
| XLogP | 4.04 |
| TPSA | 194.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.93 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|