C17H19Cl2NO — CID 67672937
(1R)-1-amino-4-(2-chlorophenyl)-3-(4-chlorophenyl)-3-methylbutan-1-ol (PubChem CID 67672937) has the molecular formula C17H19Cl2NO and a molecular weight of 324.25 g/mol. Its IUPAC name is (1R)-1-amino-4-(2-chlorophenyl)-3-(4-chlorophenyl)-3-methylbutan-1-ol.
| Compound Name | (1R)-1-amino-4-(2-chlorophenyl)-3-(4-chlorophenyl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 67672937 |
| Molecular Formula | C17H19Cl2NO |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (1R)-1-amino-4-(2-chlorophenyl)-3-(4-chlorophenyl)-3-methylbutan-1-ol |
| SMILES | CC(Cc1ccccc1Cl)(C[C@H](N)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2NO/c1-17(11-16(20)21,13-6-8-14(18)9-7-13)10-12-4-2-3-5-15(12)19/h2-9,16,21H,10-11,20H2,1H3/t16-,17?/m1/s1 |
| InChIKey | WYDVLWVKSBJQKY-TZHYSIJRSA-N |
| XLogP | 4.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|