C30H32N2O5 — CID 67673426
4-[2-[(1-benzoyl-2,3,4,5-tetrahydro-1-benzazepin-2-yl)carbamoyl]phenoxy]butyl acetate (PubChem CID 67673426) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 4-[2-[(1-benzoyl-2,3,4,5-tetrahydro-1-benzazepin-2-yl)carbamoyl]phenoxy]butyl acetate.
| Compound Name | 4-[2-[(1-benzoyl-2,3,4,5-tetrahydro-1-benzazepin-2-yl)carbamoyl]phenoxy]butyl acetate |
|---|---|
| PubChem CID | 67673426 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 4-[2-[(1-benzoyl-2,3,4,5-tetrahydro-1-benzazepin-2-yl)carbamoyl]phenoxy]butyl acetate |
| SMILES | CC(=O)OCCCCOc1ccccc1C(=O)NC1CCCc2ccccc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H32N2O5/c1-22(33)36-20-9-10-21-37-27-18-8-6-16-25(27)29(34)31-28-19-11-15-23-12-5-7-17-26(23)32(28)30(35)24-13-3-2-4-14-24/h2-8,12-14,16-18,28H,9-11,15,19-21H2,1H3,(H,31,34) |
| InChIKey | JLBFFVSTPNTNHB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|